C18H19N3O3 — CID 46383478
1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(2-methoxyphenyl)urea (PubChem CID 46383478) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 46383478 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H19N3O3/c1-24-16-9-5-3-7-14(16)20-18(23)19-12-17(22)21-11-10-13-6-2-4-8-15(13)21/h2-9H,10-12H2,1H3,(H2,19,20,23) |
| InChIKey | WVTOOWVQKHLBMS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |