C23H31N5O3 — CID 46385248
N-(3-methoxypropyl)-2-[3-[5-[(4-methylpiperidin-1-yl)methyl]-1,3,4-oxadiazol-2-yl]indol-1-yl]acetamide (PubChem CID 46385248) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[3-[5-[(4-methylpiperidin-1-yl)methyl]-1,3,4-oxadiazol-2-yl]indol-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[3-[5-[(4-methylpiperidin-1-yl)methyl]-1,3,4-oxadiazol-2-yl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 46385248 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-(3-methoxypropyl)-2-[3-[5-[(4-methylpiperidin-1-yl)methyl]-1,3,4-oxadiazol-2-yl]indol-1-yl]acetamide |
| SMILES | COCCCNC(=O)Cn1cc(-c2nnc(CN3CCC(C)CC3)o2)c2ccccc21 |
| InChI | InChI=1S/C23H31N5O3/c1-17-8-11-27(12-9-17)16-22-25-26-23(31-22)19-14-28(20-7-4-3-6-18(19)20)15-21(29)24-10-5-13-30-2/h3-4,6-7,14,17H,5,8-13,15-16H2,1-2H3,(H,24,29) |
| InChIKey | JNJYFCMUHNLAHG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|