About 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea
1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea (PubChem CID 46386097) has the molecular formula C14H21N3O3S
and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea.
Molecular Properties
| Compound Name | 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea |
| PubChem CID | 46386097 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc2c(c1)N(S(=O)(=O)CC)CC2 |
| InChI | InChI=1S/C14H21N3O3S/c1-3-8-15-14(18)16-12-6-5-11-7-9-17(13(11)10-12)21(19,20)4-2/h5-6,10H,3-4,7-9H2,1-2H3,(H2,15,16,18) |
| InChIKey | LFKZQOIJSBHANR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea?
The IUPAC name of 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea (CID 46386097) is 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea.
What is the SMILES notation for 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea?
The canonical SMILES for 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea is CCCNC(=O)Nc1ccc2c(c1)N(S(=O)(=O)CC)CC2.
What is the InChIKey of 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea?
The InChIKey is LFKZQOIJSBHANR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3S/c1-3-8-15-14(18)16-12-6-5-11-7-9-17(13(11)10-12)21(19,20)4-2/h5-6,10H,3-4,7-9H2,1-2H3,(H2,15,16,18).
What are the key properties of 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea?
1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea has a molecular weight of 311.41 g/mol, XLogP of 1.93, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)-3-propylurea is sourced from PubChem (CID 46386097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).