About 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea
1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea (PubChem CID 46386125) has the molecular formula C15H23N3O3S
and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea.
Molecular Properties
| Compound Name | 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea |
| PubChem CID | 46386125 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea |
| SMILES | CCS(=O)(=O)N1CCc2ccc(NC(=O)NC(C)(C)C)cc21 |
| InChI | InChI=1S/C15H23N3O3S/c1-5-22(20,21)18-9-8-11-6-7-12(10-13(11)18)16-14(19)17-15(2,3)4/h6-7,10H,5,8-9H2,1-4H3,(H2,16,17,19) |
| InChIKey | PPIIKQIXFXMKEV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea?
The IUPAC name of 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea (CID 46386125) is 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea.
What is the SMILES notation for 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea?
The canonical SMILES for 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea is CCS(=O)(=O)N1CCc2ccc(NC(=O)NC(C)(C)C)cc21.
What is the InChIKey of 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea?
The InChIKey is PPIIKQIXFXMKEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O3S/c1-5-22(20,21)18-9-8-11-6-7-12(10-13(11)18)16-14(19)17-15(2,3)4/h6-7,10H,5,8-9H2,1-4H3,(H2,16,17,19).
What are the key properties of 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea?
1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea has a molecular weight of 325.43 g/mol, XLogP of 2.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-(1-ethylsulfonyl-2,3-dihydroindol-6-yl)urea is sourced from PubChem (CID 46386125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).