C26H23N3O4 — CID 46387069
3-[6-(2-methoxyphenoxy)pyridazin-3-yl]-N-[(3-methoxyphenyl)methyl]benzamide (PubChem CID 46387069) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 3-[6-(2-methoxyphenoxy)pyridazin-3-yl]-N-[(3-methoxyphenyl)methyl]benzamide.
| Compound Name | 3-[6-(2-methoxyphenoxy)pyridazin-3-yl]-N-[(3-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 46387069 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-[6-(2-methoxyphenoxy)pyridazin-3-yl]-N-[(3-methoxyphenyl)methyl]benzamide |
| SMILES | COc1cccc(CNC(=O)c2cccc(-c3ccc(Oc4ccccc4OC)nn3)c2)c1 |
| InChI | InChI=1S/C26H23N3O4/c1-31-21-10-5-7-18(15-21)17-27-26(30)20-9-6-8-19(16-20)22-13-14-25(29-28-22)33-24-12-4-3-11-23(24)32-2/h3-16H,17H2,1-2H3,(H,27,30) |
| InChIKey | WNIFUCXGHQFCKZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |