C23H27N3O2S — CID 46388426
N-[(4-butoxyphenyl)methyl]-2-(2,4-dimethylanilino)-1,3-thiazole-4-carboxamide (PubChem CID 46388426) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-2-(2,4-dimethylanilino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-2-(2,4-dimethylanilino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46388426 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-2-(2,4-dimethylanilino)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCOc1ccc(CNC(=O)c2csc(Nc3ccc(C)cc3C)n2)cc1 |
| InChI | InChI=1S/C23H27N3O2S/c1-4-5-12-28-19-9-7-18(8-10-19)14-24-22(27)21-15-29-23(26-21)25-20-11-6-16(2)13-17(20)3/h6-11,13,15H,4-5,12,14H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | HZPRSRWDZGQLPT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|