C13H12ClN3O2S — CID 46388432
4-chloro-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide (PubChem CID 46388432) has the molecular formula C13H12ClN3O2S and a molecular weight of 309.78 g/mol. Its IUPAC name is 4-chloro-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 46388432 |
| Molecular Formula | C13H12ClN3O2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 4-chloro-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1)NCc1cscn1 |
| InChI | InChI=1S/C13H12ClN3O2S/c14-10-3-1-9(2-4-10)13(19)16-6-12(18)15-5-11-7-20-8-17-11/h1-4,7-8H,5-6H2,(H,15,18)(H,16,19) |
| InChIKey | SYWJFYNXURFUFM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |