About 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide
3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide (PubChem CID 46388446) has the molecular formula C13H12BrN3O2S
and a molecular weight of 354.23 g/mol. Its IUPAC name is 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide.
Molecular Properties
| Compound Name | 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide |
| PubChem CID | 46388446 |
| Molecular Formula | C13H12BrN3O2S |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)NCc1cscn1 |
| InChI | InChI=1S/C13H12BrN3O2S/c14-10-3-1-2-9(4-10)13(19)16-6-12(18)15-5-11-7-20-8-17-11/h1-4,7-8H,5-6H2,(H,15,18)(H,16,19) |
| InChIKey | RFFRUWQVFXFCQH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide?
The IUPAC name of 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide (CID 46388446) is 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide.
What is the SMILES notation for 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide?
The canonical SMILES for 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide is O=C(CNC(=O)c1cccc(Br)c1)NCc1cscn1.
What is the InChIKey of 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide?
The InChIKey is RFFRUWQVFXFCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrN3O2S/c14-10-3-1-2-9(4-10)13(19)16-6-12(18)15-5-11-7-20-8-17-11/h1-4,7-8H,5-6H2,(H,15,18)(H,16,19).
What are the key properties of 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide?
3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide has a molecular weight of 354.23 g/mol, XLogP of 1.95, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]benzamide is sourced from PubChem (CID 46388446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).