About [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate
[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate (PubChem CID 4638997) has the molecular formula C16H19Cl2NO4
and a molecular weight of 360.24 g/mol. Its IUPAC name is [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate.
Molecular Properties
| Compound Name | [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate |
| PubChem CID | 4638997 |
| Molecular Formula | C16H19Cl2NO4 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate |
| SMILES | CC1CN(C(=O)COC(=O)Cc2c(Cl)cccc2Cl)CC(C)O1 |
| InChI | InChI=1S/C16H19Cl2NO4/c1-10-7-19(8-11(2)23-10)15(20)9-22-16(21)6-12-13(17)4-3-5-14(12)18/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | RTJUXBOMBIAWJS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate?
The IUPAC name of [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate (CID 4638997) is [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate.
What is the SMILES notation for [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate?
The canonical SMILES for [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate is CC1CN(C(=O)COC(=O)Cc2c(Cl)cccc2Cl)CC(C)O1.
What is the InChIKey of [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate?
The InChIKey is RTJUXBOMBIAWJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19Cl2NO4/c1-10-7-19(8-11(2)23-10)15(20)9-22-16(21)6-12-13(17)4-3-5-14(12)18/h3-5,10-11H,6-9H2,1-2H3.
What are the key properties of [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate?
[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate has a molecular weight of 360.24 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate is sourced from PubChem (CID 4638997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).