About 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine
2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine (PubChem CID 4639026) has the molecular formula C6H9N7O3
and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine.
Molecular Properties
| Compound Name | 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine |
| PubChem CID | 4639026 |
| Molecular Formula | C6H9N7O3 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine |
| SMILES | CC(=NN=C(N)N[N+](=O)[O-])c1nonc1C |
| InChI | InChI=1S/C6H9N7O3/c1-3(5-4(2)11-16-12-5)8-9-6(7)10-13(14)15/h1-2H3,(H3,7,9,10) |
| InChIKey | KHHQPUSZIPGCAA-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine?
The IUPAC name of 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine (CID 4639026) is 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine.
What is the SMILES notation for 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine?
The canonical SMILES for 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine is CC(=NN=C(N)N[N+](=O)[O-])c1nonc1C.
What is the InChIKey of 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine?
The InChIKey is KHHQPUSZIPGCAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N7O3/c1-3(5-4(2)11-16-12-5)8-9-6(7)10-13(14)15/h1-2H3,(H3,7,9,10).
What are the key properties of 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine?
2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine has a molecular weight of 227.18 g/mol, XLogP of -0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylideneamino]-1-nitroguanidine is sourced from PubChem (CID 4639026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).