About ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate
ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate (PubChem CID 46390722) has the molecular formula C15H22N4O5
and a molecular weight of 338.36 g/mol. Its IUPAC name is ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate |
| PubChem CID | 46390722 |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(CNC(=O)Nc2c[nH]c(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C15H22N4O5/c1-2-24-13(21)10-5-3-9(4-6-10)7-16-14(22)18-11-8-17-15(23)19-12(11)20/h8-10H,2-7H2,1H3,(H2,16,18,22)(H2,17,19,20,23) |
| InChIKey | SAVIZGXLSWAXQK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate (CID 46390722) is ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate is CCOC(=O)C1CCC(CNC(=O)Nc2c[nH]c(=O)[nH]c2=O)CC1.
What is the InChIKey of ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate?
The InChIKey is SAVIZGXLSWAXQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O5/c1-2-24-13(21)10-5-3-9(4-6-10)7-16-14(22)18-11-8-17-15(23)19-12(11)20/h8-10H,2-7H2,1H3,(H2,16,18,22)(H2,17,19,20,23).
What are the key properties of ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate?
ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate has a molecular weight of 338.36 g/mol, XLogP of 0.55, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[(2,4-dioxo-1H-pyrimidin-5-yl)carbamoylamino]methyl]cyclohexane-1-carboxylate is sourced from PubChem (CID 46390722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).