C25H33N5O3S — CID 46391070
2-[2-(4-methylpiperidin-1-yl)-5,7-dioxo-6-propyl-[1,3]thiazolo[4,5-d]pyrimidin-4-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 46391070) has the molecular formula C25H33N5O3S and a molecular weight of 483.64 g/mol. Its IUPAC name is 2-[2-(4-methylpiperidin-1-yl)-5,7-dioxo-6-propyl-[1,3]thiazolo[4,5-d]pyrimidin-4-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[2-(4-methylpiperidin-1-yl)-5,7-dioxo-6-propyl-[1,3]thiazolo[4,5-d]pyrimidin-4-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 46391070 |
| Molecular Formula | C25H33N5O3S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 2-[2-(4-methylpiperidin-1-yl)-5,7-dioxo-6-propyl-[1,3]thiazolo[4,5-d]pyrimidin-4-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCCn1c(=O)c2sc(N3CCC(C)CC3)nc2n(CC(=O)Nc2c(C)cc(C)cc2C)c1=O |
| InChI | InChI=1S/C25H33N5O3S/c1-6-9-29-23(32)21-22(27-24(34-21)28-10-7-15(2)8-11-28)30(25(29)33)14-19(31)26-20-17(4)12-16(3)13-18(20)5/h12-13,15H,6-11,14H2,1-5H3,(H,26,31) |
| InChIKey | UXYJEXMWEHCQDA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |