C23H25N5O4S — CID 46391077
N-(4-acetylphenyl)-2-(5,7-dioxo-2-piperidin-1-yl-6-prop-2-enyl-[1,3]thiazolo[4,5-d]pyrimidin-4-yl)acetamide (PubChem CID 46391077) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(5,7-dioxo-2-piperidin-1-yl-6-prop-2-enyl-[1,3]thiazolo[4,5-d]pyrimidin-4-yl)acetamide.
| Compound Name | N-(4-acetylphenyl)-2-(5,7-dioxo-2-piperidin-1-yl-6-prop-2-enyl-[1,3]thiazolo[4,5-d]pyrimidin-4-yl)acetamide |
|---|---|
| PubChem CID | 46391077 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-(4-acetylphenyl)-2-(5,7-dioxo-2-piperidin-1-yl-6-prop-2-enyl-[1,3]thiazolo[4,5-d]pyrimidin-4-yl)acetamide |
| SMILES | C=CCn1c(=O)c2sc(N3CCCCC3)nc2n(CC(=O)Nc2ccc(C(C)=O)cc2)c1=O |
| InChI | InChI=1S/C23H25N5O4S/c1-3-11-27-21(31)19-20(25-22(33-19)26-12-5-4-6-13-26)28(23(27)32)14-18(30)24-17-9-7-16(8-10-17)15(2)29/h3,7-10H,1,4-6,11-14H2,2H3,(H,24,30) |
| InChIKey | NCJPMIYJJHDCCC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|