C19H20ClNO6 — CID 4639150
dimethyl 4-(4-chlorophenyl)-1-(1-methoxy-1-oxopropan-2-yl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 4639150) has the molecular formula C19H20ClNO6 and a molecular weight of 393.82 g/mol. Its IUPAC name is dimethyl 4-(4-chlorophenyl)-1-(1-methoxy-1-oxopropan-2-yl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(4-chlorophenyl)-1-(1-methoxy-1-oxopropan-2-yl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 4639150 |
| Molecular Formula | C19H20ClNO6 |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | dimethyl 4-(4-chlorophenyl)-1-(1-methoxy-1-oxopropan-2-yl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=CN(C(C)C(=O)OC)C=C(C(=O)OC)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO6/c1-11(17(22)25-2)21-9-14(18(23)26-3)16(15(10-21)19(24)27-4)12-5-7-13(20)8-6-12/h5-11,16H,1-4H3 |
| InChIKey | VURXKGWZTHHSDG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|