About N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide
N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide (PubChem CID 46392966) has the molecular formula C16H22N2O2S3
and a molecular weight of 370.57 g/mol. Its IUPAC name is N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide.
Molecular Properties
| Compound Name | N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide |
| PubChem CID | 46392966 |
| Molecular Formula | C16H22N2O2S3 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide |
| SMILES | Cc1nc(-c2cc(S(=O)(=O)NC3CCCCC3)c(C)s2)sc1C |
| InChI | InChI=1S/C16H22N2O2S3/c1-10-11(2)22-16(17-10)14-9-15(12(3)21-14)23(19,20)18-13-7-5-4-6-8-13/h9,13,18H,4-8H2,1-3H3 |
| InChIKey | FJBJWAXGNVHUNT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide?
The IUPAC name of N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide (CID 46392966) is N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide.
What is the SMILES notation for N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide?
The canonical SMILES for N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide is Cc1nc(-c2cc(S(=O)(=O)NC3CCCCC3)c(C)s2)sc1C.
What is the InChIKey of N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide?
The InChIKey is FJBJWAXGNVHUNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2S3/c1-10-11(2)22-16(17-10)14-9-15(12(3)21-14)23(19,20)18-13-7-5-4-6-8-13/h9,13,18H,4-8H2,1-3H3.
What are the key properties of N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide?
N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide has a molecular weight of 370.57 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylthiophene-3-sulfonamide is sourced from PubChem (CID 46392966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).