C26H22N2O7 — CID 4639346
3-(1-methylindol-3-yl)-4-[1-(3,4,5-trihydroxyoxan-2-yl)indol-3-yl]furan-2,5-dione (PubChem CID 4639346) has the molecular formula C26H22N2O7 and a molecular weight of 474.47 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-4-[1-(3,4,5-trihydroxyoxan-2-yl)indol-3-yl]furan-2,5-dione.
| Compound Name | 3-(1-methylindol-3-yl)-4-[1-(3,4,5-trihydroxyoxan-2-yl)indol-3-yl]furan-2,5-dione |
|---|---|
| PubChem CID | 4639346 |
| Molecular Formula | C26H22N2O7 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-(1-methylindol-3-yl)-4-[1-(3,4,5-trihydroxyoxan-2-yl)indol-3-yl]furan-2,5-dione |
| SMILES | Cn1cc(C2=C(c3cn(C4OCC(O)C(O)C4O)c4ccccc34)C(=O)OC2=O)c2ccccc21 |
| InChI | InChI=1S/C26H22N2O7/c1-27-10-15(13-6-2-4-8-17(13)27)20-21(26(33)35-25(20)32)16-11-28(18-9-5-3-7-14(16)18)24-23(31)22(30)19(29)12-34-24/h2-11,19,22-24,29-31H,12H2,1H3 |
| InChIKey | JRFKSHZYPDLHQB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|