C24H30N6O3 — CID 46393489
N-[3-(azepan-1-yl)propyl]-3-[[3-(4-methylphenyl)-6-oxopyridazin-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 46393489) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-3-[[3-(4-methylphenyl)-6-oxopyridazin-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-3-[[3-(4-methylphenyl)-6-oxopyridazin-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 46393489 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-3-[[3-(4-methylphenyl)-6-oxopyridazin-1-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1ccc(-c2ccc(=O)n(Cc3noc(C(=O)NCCCN4CCCCCC4)n3)n2)cc1 |
| InChI | InChI=1S/C24H30N6O3/c1-18-7-9-19(10-8-18)20-11-12-22(31)30(27-20)17-21-26-24(33-28-21)23(32)25-13-6-16-29-14-4-2-3-5-15-29/h7-12H,2-6,13-17H2,1H3,(H,25,32) |
| InChIKey | ZKTYLCQUWWUVAX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|