About 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid
2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid (PubChem CID 4639375) has the molecular formula C7H12N4O2S
and a molecular weight of 216.27 g/mol. Its IUPAC name is 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
| PubChem CID | 4639375 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
| SMILES | CCCc1nnc(SCC(=O)O)n1N |
| InChI | InChI=1S/C7H12N4O2S/c1-2-3-5-9-10-7(11(5)8)14-4-6(12)13/h2-4,8H2,1H3,(H,12,13) |
| InChIKey | MMMSXTGJVFHQHI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid?
The IUPAC name of 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid (CID 4639375) is 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid.
What is the SMILES notation for 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid?
The canonical SMILES for 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid is CCCc1nnc(SCC(=O)O)n1N.
What is the InChIKey of 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid?
The InChIKey is MMMSXTGJVFHQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2S/c1-2-3-5-9-10-7(11(5)8)14-4-6(12)13/h2-4,8H2,1H3,(H,12,13).
What are the key properties of 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid?
2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid has a molecular weight of 216.27 g/mol, XLogP of 0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-5-propyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid is sourced from PubChem (CID 4639375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).