C20H22N4O3 — CID 46393924
N-(2-methoxyethyl)-4-(3-oxo-4-propylpyrido[2,3-b]pyrazin-2-yl)benzamide (PubChem CID 46393924) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(3-oxo-4-propylpyrido[2,3-b]pyrazin-2-yl)benzamide.
| Compound Name | N-(2-methoxyethyl)-4-(3-oxo-4-propylpyrido[2,3-b]pyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 46393924 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-(2-methoxyethyl)-4-(3-oxo-4-propylpyrido[2,3-b]pyrazin-2-yl)benzamide |
| SMILES | CCCn1c(=O)c(-c2ccc(C(=O)NCCOC)cc2)nc2cccnc21 |
| InChI | InChI=1S/C20H22N4O3/c1-3-12-24-18-16(5-4-10-21-18)23-17(20(24)26)14-6-8-15(9-7-14)19(25)22-11-13-27-2/h4-10H,3,11-13H2,1-2H3,(H,22,25) |
| InChIKey | WRXBVGCSPDCRTM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|