About methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate
methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate (PubChem CID 46394483) has the molecular formula C20H23N3O3
and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate |
| PubChem CID | 46394483 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(C(=O)N2CCN(c3cccc(C)c3C)CC2)n1 |
| InChI | InChI=1S/C20H23N3O3/c1-14-6-4-9-18(15(14)2)22-10-12-23(13-11-22)19(24)16-7-5-8-17(21-16)20(25)26-3/h4-9H,10-13H2,1-3H3 |
| InChIKey | IEOQMKKJBVYKRS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate?
The IUPAC name of methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate (CID 46394483) is methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate?
The canonical SMILES for methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate is COC(=O)c1cccc(C(=O)N2CCN(c3cccc(C)c3C)CC2)n1.
What is the InChIKey of methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate?
The InChIKey is IEOQMKKJBVYKRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O3/c1-14-6-4-9-18(15(14)2)22-10-12-23(13-11-22)19(24)16-7-5-8-17(21-16)20(25)26-3/h4-9H,10-13H2,1-3H3.
What are the key properties of methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate?
methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate has a molecular weight of 353.42 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate is sourced from PubChem (CID 46394483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).