About methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate
methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate (PubChem CID 46394493) has the molecular formula C16H16N2O3
and a molecular weight of 284.32 g/mol. Its IUPAC name is methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate |
| PubChem CID | 46394493 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(C(=O)Nc2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C16H16N2O3/c1-10-7-11(2)9-12(8-10)17-15(19)13-5-4-6-14(18-13)16(20)21-3/h4-9H,1-3H3,(H,17,19) |
| InChIKey | ADDQVUPEHGWLNL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate?
The IUPAC name of methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate (CID 46394493) is methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate?
The canonical SMILES for methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate is COC(=O)c1cccc(C(=O)Nc2cc(C)cc(C)c2)n1.
What is the InChIKey of methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate?
The InChIKey is ADDQVUPEHGWLNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-10-7-11(2)9-12(8-10)17-15(19)13-5-4-6-14(18-13)16(20)21-3/h4-9H,1-3H3,(H,17,19).
What are the key properties of methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate?
methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate has a molecular weight of 284.32 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(3,5-dimethylphenyl)carbamoyl]pyridine-2-carboxylate is sourced from PubChem (CID 46394493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).