C22H12F3N3O3S — CID 46395015
3-[2-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 46395015) has the molecular formula C22H12F3N3O3S and a molecular weight of 455.42 g/mol. Its IUPAC name is 3-[2-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 46395015 |
| Molecular Formula | C22H12F3N3O3S |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 3-[2-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1csc(Cc2nc(-c3ccc(C(F)(F)F)cc3)no2)n1 |
| InChI | InChI=1S/C22H12F3N3O3S/c23-22(24,25)14-7-5-12(6-8-14)20-27-18(31-28-20)10-19-26-16(11-32-19)15-9-13-3-1-2-4-17(13)30-21(15)29/h1-9,11H,10H2 |
| InChIKey | UDTTZLVNQHXXPF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 82.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|