C21H14N4O4S — CID 46395034
7-methoxy-3-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 46395034) has the molecular formula C21H14N4O4S and a molecular weight of 418.43 g/mol. Its IUPAC name is 7-methoxy-3-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 7-methoxy-3-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 46395034 |
| Molecular Formula | C21H14N4O4S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 7-methoxy-3-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | COc1ccc2cc(-c3csc(Cc4nc(-c5cccnc5)no4)n3)c(=O)oc2c1 |
| InChI | InChI=1S/C21H14N4O4S/c1-27-14-5-4-12-7-15(21(26)28-17(12)8-14)16-11-30-19(23-16)9-18-24-20(25-29-18)13-3-2-6-22-10-13/h2-8,10-11H,9H2,1H3 |
| InChIKey | VMMSFVPBYKIXOR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|