About diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate
diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate (PubChem CID 4639511) has the molecular formula C24H23F2NO4
and a molecular weight of 427.45 g/mol. Its IUPAC name is diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate |
| PubChem CID | 4639511 |
| Molecular Formula | C24H23F2NO4 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CN(Cc2ccc(F)cc2)C=C(C(=O)OCC)C1c1cccc(F)c1 |
| InChI | InChI=1S/C24H23F2NO4/c1-3-30-23(28)20-14-27(13-16-8-10-18(25)11-9-16)15-21(24(29)31-4-2)22(20)17-6-5-7-19(26)12-17/h5-12,14-15,22H,3-4,13H2,1-2H3 |
| InChIKey | ILEYJZLQPIZFRK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate (CID 4639511) is diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate is CCOC(=O)C1=CN(Cc2ccc(F)cc2)C=C(C(=O)OCC)C1c1cccc(F)c1.
What is the InChIKey of diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate?
The InChIKey is ILEYJZLQPIZFRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23F2NO4/c1-3-30-23(28)20-14-27(13-16-8-10-18(25)11-9-16)15-21(24(29)31-4-2)22(20)17-6-5-7-19(26)12-17/h5-12,14-15,22H,3-4,13H2,1-2H3.
What are the key properties of diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate?
diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate has a molecular weight of 427.45 g/mol, XLogP of 4.46, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 4639511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).