About N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide
N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide (PubChem CID 46395491) has the molecular formula C20H27N3OS
and a molecular weight of 357.52 g/mol. Its IUPAC name is N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide |
| PubChem CID | 46395491 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide |
| SMILES | O=C(NC1CCCCCC1)C1CCN(c2nccc3sccc23)CC1 |
| InChI | InChI=1S/C20H27N3OS/c24-20(22-16-5-3-1-2-4-6-16)15-8-12-23(13-9-15)19-17-10-14-25-18(17)7-11-21-19/h7,10-11,14-16H,1-6,8-9,12-13H2,(H,22,24) |
| InChIKey | IRWGVOPPUOSGCB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide?
The IUPAC name of N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide (CID 46395491) is N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide.
What is the SMILES notation for N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide?
The canonical SMILES for N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide is O=C(NC1CCCCCC1)C1CCN(c2nccc3sccc23)CC1.
What is the InChIKey of N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide?
The InChIKey is IRWGVOPPUOSGCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3OS/c24-20(22-16-5-3-1-2-4-6-16)15-8-12-23(13-9-15)19-17-10-14-25-18(17)7-11-21-19/h7,10-11,14-16H,1-6,8-9,12-13H2,(H,22,24).
What are the key properties of N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide?
N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide has a molecular weight of 357.52 g/mol, XLogP of 4.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide is sourced from PubChem (CID 46395491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).