C15H11FN2O2S — CID 46396043
N-(3-fluorophenyl)-2-(4-oxothieno[3,2-c]pyridin-5-yl)acetamide (PubChem CID 46396043) has the molecular formula C15H11FN2O2S and a molecular weight of 302.33 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-(4-oxothieno[3,2-c]pyridin-5-yl)acetamide.
| Compound Name | N-(3-fluorophenyl)-2-(4-oxothieno[3,2-c]pyridin-5-yl)acetamide |
|---|---|
| PubChem CID | 46396043 |
| Molecular Formula | C15H11FN2O2S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | N-(3-fluorophenyl)-2-(4-oxothieno[3,2-c]pyridin-5-yl)acetamide |
| SMILES | O=C(Cn1ccc2sccc2c1=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H11FN2O2S/c16-10-2-1-3-11(8-10)17-14(19)9-18-6-4-13-12(15(18)20)5-7-21-13/h1-8H,9H2,(H,17,19) |
| InChIKey | OMJRSECMGGPXFA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |