C25H29N3OS — CID 46396546
(4-benzylpiperidin-1-yl)-(1-thieno[3,2-c]pyridin-4-ylpiperidin-3-yl)methanone (PubChem CID 46396546) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-(1-thieno[3,2-c]pyridin-4-ylpiperidin-3-yl)methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-(1-thieno[3,2-c]pyridin-4-ylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 46396546 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-(1-thieno[3,2-c]pyridin-4-ylpiperidin-3-yl)methanone |
| SMILES | O=C(C1CCCN(c2nccc3sccc23)C1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H29N3OS/c29-25(27-14-9-20(10-15-27)17-19-5-2-1-3-6-19)21-7-4-13-28(18-21)24-22-11-16-30-23(22)8-12-26-24/h1-3,5-6,8,11-12,16,20-21H,4,7,9-10,13-15,17-18H2 |
| InChIKey | XOJXHWYWTAWAAB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |