About N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide
N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide (PubChem CID 46396668) has the molecular formula C14H18N2OS2
and a molecular weight of 294.44 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide.
Molecular Properties
| Compound Name | N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide |
| PubChem CID | 46396668 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide |
| SMILES | CCCC(=O)N(CCc1cscn1)Cc1ccsc1 |
| InChI | InChI=1S/C14H18N2OS2/c1-2-3-14(17)16(8-12-5-7-18-9-12)6-4-13-10-19-11-15-13/h5,7,9-11H,2-4,6,8H2,1H3 |
| InChIKey | IMRBZZWCISAALZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide?
The IUPAC name of N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide (CID 46396668) is N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide.
What is the SMILES notation for N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide?
The canonical SMILES for N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide is CCCC(=O)N(CCc1cscn1)Cc1ccsc1.
What is the InChIKey of N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide?
The InChIKey is IMRBZZWCISAALZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2OS2/c1-2-3-14(17)16(8-12-5-7-18-9-12)6-4-13-10-19-11-15-13/h5,7,9-11H,2-4,6,8H2,1H3.
What are the key properties of N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide?
N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide has a molecular weight of 294.44 g/mol, XLogP of 3.58, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,3-thiazol-4-yl)ethyl]-N-(thiophen-3-ylmethyl)butanamide is sourced from PubChem (CID 46396668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).