About N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide
N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide (PubChem CID 46396702) has the molecular formula C17H29N3O
and a molecular weight of 291.44 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide |
| PubChem CID | 46396702 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide |
| SMILES | Cc1nn(C)c(C)c1CN(CC(C)C)C(=O)C1CCCC1 |
| InChI | InChI=1S/C17H29N3O/c1-12(2)10-20(17(21)15-8-6-7-9-15)11-16-13(3)18-19(5)14(16)4/h12,15H,6-11H2,1-5H3 |
| InChIKey | HKRLDIVQZOUCAV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide?
The IUPAC name of N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide (CID 46396702) is N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide.
What is the SMILES notation for N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide?
The canonical SMILES for N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide is Cc1nn(C)c(C)c1CN(CC(C)C)C(=O)C1CCCC1.
What is the InChIKey of N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide?
The InChIKey is HKRLDIVQZOUCAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O/c1-12(2)10-20(17(21)15-8-6-7-9-15)11-16-13(3)18-19(5)14(16)4/h12,15H,6-11H2,1-5H3.
What are the key properties of N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide?
N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide has a molecular weight of 291.44 g/mol, XLogP of 3.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]cyclopentanecarboxamide is sourced from PubChem (CID 46396702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).