C21H34N4O3S — CID 46397211
2-[1-(3-methylphenyl)sulfonylpiperidin-3-yl]-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide (PubChem CID 46397211) has the molecular formula C21H34N4O3S and a molecular weight of 422.60 g/mol. Its IUPAC name is 2-[1-(3-methylphenyl)sulfonylpiperidin-3-yl]-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide.
| Compound Name | 2-[1-(3-methylphenyl)sulfonylpiperidin-3-yl]-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 46397211 |
| Molecular Formula | C21H34N4O3S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[1-(3-methylphenyl)sulfonylpiperidin-3-yl]-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide |
| SMILES | Cc1cccc(S(=O)(=O)N2CCCC(CC(=O)NCCN3CCN(C)CC3)C2)c1 |
| InChI | InChI=1S/C21H34N4O3S/c1-18-5-3-7-20(15-18)29(27,28)25-9-4-6-19(17-25)16-21(26)22-8-10-24-13-11-23(2)12-14-24/h3,5,7,15,19H,4,6,8-14,16-17H2,1-2H3,(H,22,26) |
| InChIKey | FHJOGWKVXWOSNL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |