About 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide
1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide (PubChem CID 46397273) has the molecular formula C16H16N4O2S
and a molecular weight of 328.40 g/mol. Its IUPAC name is 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide |
| PubChem CID | 46397273 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)Nc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C16H16N4O2S/c21-23(22,11-15-4-2-1-3-5-15)19-16-8-6-14(7-9-16)10-20-13-17-12-18-20/h1-9,12-13,19H,10-11H2 |
| InChIKey | AOEBVBASYUJYGI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide?
The IUPAC name of 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide (CID 46397273) is 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide.
What is the SMILES notation for 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide?
The canonical SMILES for 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide is O=S(=O)(Cc1ccccc1)Nc1ccc(Cn2cncn2)cc1.
What is the InChIKey of 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide?
The InChIKey is AOEBVBASYUJYGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2S/c21-23(22,11-15-4-2-1-3-5-15)19-16-8-6-14(7-9-16)10-20-13-17-12-18-20/h1-9,12-13,19H,10-11H2.
What are the key properties of 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide?
1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide has a molecular weight of 328.40 g/mol, XLogP of 2.27, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanesulfonamide is sourced from PubChem (CID 46397273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).