About 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 46397599) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
Analyze 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (CID 46397599) is 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine is Cc1cc(N)n2nc(C)nc2n1.
What is the InChIKey of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is BQKZYIZFKSPMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c1-4-3-6(8)12-7(9-4)10-5(2)11-12/h3H,8H2,1-2H3.
What are the key properties of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 163.18 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 46397599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).