About 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline
2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline (PubChem CID 46397968) has the molecular formula C15H14N4O
and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline.
Molecular Properties
| Compound Name | 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline |
| PubChem CID | 46397968 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline |
| SMILES | COc1cccc(-c2n[nH]c(-c3ccccc3N)n2)c1 |
| InChI | InChI=1S/C15H14N4O/c1-20-11-6-4-5-10(9-11)14-17-15(19-18-14)12-7-2-3-8-13(12)16/h2-9H,16H2,1H3,(H,17,18,19) |
| InChIKey | XPEPLSMWWCIUKW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline?
The IUPAC name of 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline (CID 46397968) is 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline.
What is the SMILES notation for 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline?
The canonical SMILES for 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline is COc1cccc(-c2n[nH]c(-c3ccccc3N)n2)c1.
What is the InChIKey of 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline?
The InChIKey is XPEPLSMWWCIUKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O/c1-20-11-6-4-5-10(9-11)14-17-15(19-18-14)12-7-2-3-8-13(12)16/h2-9H,16H2,1H3,(H,17,18,19).
What are the key properties of 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline?
2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline has a molecular weight of 266.30 g/mol, XLogP of 2.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-methoxyphenyl)-1H-1,2,4-triazol-5-yl]aniline is sourced from PubChem (CID 46397968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).