About 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine
2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine (PubChem CID 46397977) has the molecular formula C9H11N5
and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine.
Molecular Properties
| Compound Name | 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine |
| PubChem CID | 46397977 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine |
| SMILES | CC(C)c1nc(-c2cnccn2)n[nH]1 |
| InChI | InChI=1S/C9H11N5/c1-6(2)8-12-9(14-13-8)7-5-10-3-4-11-7/h3-6H,1-2H3,(H,12,13,14) |
| InChIKey | FLYCWSKOGHBKFX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine?
The IUPAC name of 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine (CID 46397977) is 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine.
What is the SMILES notation for 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine?
The canonical SMILES for 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine is CC(C)c1nc(-c2cnccn2)n[nH]1.
What is the InChIKey of 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine?
The InChIKey is FLYCWSKOGHBKFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5/c1-6(2)8-12-9(14-13-8)7-5-10-3-4-11-7/h3-6H,1-2H3,(H,12,13,14).
What are the key properties of 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine?
2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine has a molecular weight of 189.22 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)pyrazine is sourced from PubChem (CID 46397977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).