About 6-isocyanopyridin-3-ol
6-isocyanopyridin-3-ol (PubChem CID 46398147) has the molecular formula C6H4N2O
and a molecular weight of 120.11 g/mol. Its IUPAC name is 6-isocyanopyridin-3-ol.
Molecular Properties
| Compound Name | 6-isocyanopyridin-3-ol |
| PubChem CID | 46398147 |
| Molecular Formula | C6H4N2O |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.03 |
| IUPAC Name | 6-isocyanopyridin-3-ol |
| SMILES | [C-]#[N+]c1ccc(O)cn1 |
| InChI | InChI=1S/C6H4N2O/c1-7-6-3-2-5(9)4-8-6/h2-4,9H |
| InChIKey | KMYRUUSIOTYIQM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 37.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-isocyanopyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-isocyanopyridin-3-ol?
The IUPAC name of 6-isocyanopyridin-3-ol (CID 46398147) is 6-isocyanopyridin-3-ol.
What is the SMILES notation for 6-isocyanopyridin-3-ol?
The canonical SMILES for 6-isocyanopyridin-3-ol is [C-]#[N+]c1ccc(O)cn1.
What is the InChIKey of 6-isocyanopyridin-3-ol?
The InChIKey is KMYRUUSIOTYIQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O/c1-7-6-3-2-5(9)4-8-6/h2-4,9H.
What are the key properties of 6-isocyanopyridin-3-ol?
6-isocyanopyridin-3-ol has a molecular weight of 120.11 g/mol, XLogP of 1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-isocyanopyridin-3-ol is sourced from PubChem (CID 46398147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).