About 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide
2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide (PubChem CID 46398665) has the molecular formula C8H15ClN2O4S
and a molecular weight of 270.74 g/mol. Its IUPAC name is 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide.
Molecular Properties
| Compound Name | 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide |
| PubChem CID | 46398665 |
| Molecular Formula | C8H15ClN2O4S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide |
| SMILES | CN(C)N(C(=O)CCl)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C8H15ClN2O4S/c1-10(2)11(8(13)3-9)6-4-16(14,15)5-7(6)12/h6-7,12H,3-5H2,1-2H3 |
| InChIKey | AVJCIEUYVYFNFE-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide?
The IUPAC name of 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide (CID 46398665) is 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide.
What is the SMILES notation for 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide?
The canonical SMILES for 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide is CN(C)N(C(=O)CCl)C1CS(=O)(=O)CC1O.
What is the InChIKey of 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide?
The InChIKey is AVJCIEUYVYFNFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClN2O4S/c1-10(2)11(8(13)3-9)6-4-16(14,15)5-7(6)12/h6-7,12H,3-5H2,1-2H3.
What are the key properties of 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide?
2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide has a molecular weight of 270.74 g/mol, XLogP of -1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide is sourced from PubChem (CID 46398665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).