C13H16ClNO5S — CID 46398674
2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methoxyphenyl)acetamide (PubChem CID 46398674) has the molecular formula C13H16ClNO5S and a molecular weight of 333.79 g/mol. Its IUPAC name is 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46398674 |
| Molecular Formula | C13H16ClNO5S |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(N(C(=O)CCl)C2CS(=O)(=O)CC2O)c1 |
| InChI | InChI=1S/C13H16ClNO5S/c1-20-10-4-2-3-9(5-10)15(13(17)6-14)11-7-21(18,19)8-12(11)16/h2-5,11-12,16H,6-8H2,1H3 |
| InChIKey | SLHOGXXRCOKLNB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|