C6H8N2O3 — CID 46398720
4-methoxy-1-methylpyrazole-5-carboxylic acid (PubChem CID 46398720) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 4-methoxy-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-methoxy-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 46398720 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 4-methoxy-1-methylpyrazole-5-carboxylic acid |
| SMILES | COc1cnn(C)c1C(=O)O |
| InChI | InChI=1S/C6H8N2O3/c1-8-5(6(9)10)4(11-2)3-7-8/h3H,1-2H3,(H,9,10) |
| InChIKey | MTCFHHJNRCHACG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |