C20H27NO3 — CID 46399859
N-[2-(3-methoxyphenoxy)ethyl]adamantane-2-carboxamide (PubChem CID 46399859) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[2-(3-methoxyphenoxy)ethyl]adamantane-2-carboxamide.
| Compound Name | N-[2-(3-methoxyphenoxy)ethyl]adamantane-2-carboxamide |
|---|---|
| PubChem CID | 46399859 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-[2-(3-methoxyphenoxy)ethyl]adamantane-2-carboxamide |
| SMILES | COc1cccc(OCCNC(=O)C2C3CC4CC(C3)CC2C4)c1 |
| InChI | InChI=1S/C20H27NO3/c1-23-17-3-2-4-18(12-17)24-6-5-21-20(22)19-15-8-13-7-14(10-15)11-16(19)9-13/h2-4,12-16,19H,5-11H2,1H3,(H,21,22) |
| InChIKey | OCBJJNZGDHEQLE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|