C22H26N2O5 — CID 46400008
1-(4-ethoxyphenyl)-N-[2-(3-methoxyphenoxy)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 46400008) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-N-[2-(3-methoxyphenoxy)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-ethoxyphenyl)-N-[2-(3-methoxyphenoxy)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46400008 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-(4-ethoxyphenyl)-N-[2-(3-methoxyphenoxy)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1ccc(N2CC(C(=O)NCCOc3cccc(OC)c3)CC2=O)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-3-28-18-9-7-17(8-10-18)24-15-16(13-21(24)25)22(26)23-11-12-29-20-6-4-5-19(14-20)27-2/h4-10,14,16H,3,11-13,15H2,1-2H3,(H,23,26) |
| InChIKey | MXELJZYFOMJFOE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|