C26H29N3O3 — CID 46402085
N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide (PubChem CID 46402085) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide.
| Compound Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide |
|---|---|
| PubChem CID | 46402085 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide |
| SMILES | C=CCc1ccc(OCC(=O)NC2CCCc3c2cnn3Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C26H29N3O3/c1-3-8-19-13-14-24(25(15-19)31-2)32-18-26(30)28-22-11-7-12-23-21(22)16-27-29(23)17-20-9-5-4-6-10-20/h3-6,9-10,13-16,22H,1,7-8,11-12,17-18H2,2H3,(H,28,30) |
| InChIKey | VIZAVDURDGVLKY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|