C23H25FN4O4S — CID 46402507
6-cyclopropyl-1-(1,1-dioxothiolan-3-yl)-N-[2-(4-fluorophenoxy)ethyl]-3-methylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 46402507) has the molecular formula C23H25FN4O4S and a molecular weight of 472.54 g/mol. Its IUPAC name is 6-cyclopropyl-1-(1,1-dioxothiolan-3-yl)-N-[2-(4-fluorophenoxy)ethyl]-3-methylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-cyclopropyl-1-(1,1-dioxothiolan-3-yl)-N-[2-(4-fluorophenoxy)ethyl]-3-methylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46402507 |
| Molecular Formula | C23H25FN4O4S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 6-cyclopropyl-1-(1,1-dioxothiolan-3-yl)-N-[2-(4-fluorophenoxy)ethyl]-3-methylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1nn(C2CCS(=O)(=O)C2)c2nc(C3CC3)cc(C(=O)NCCOc3ccc(F)cc3)c12 |
| InChI | InChI=1S/C23H25FN4O4S/c1-14-21-19(23(29)25-9-10-32-18-6-4-16(24)5-7-18)12-20(15-2-3-15)26-22(21)28(27-14)17-8-11-33(30,31)13-17/h4-7,12,15,17H,2-3,8-11,13H2,1H3,(H,25,29) |
| InChIKey | AZDJSCAEPBQKRE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|