About 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione
4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione (PubChem CID 4640407) has the molecular formula C17H13N3OS3
and a molecular weight of 371.51 g/mol. Its IUPAC name is 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione |
| PubChem CID | 4640407 |
| Molecular Formula | C17H13N3OS3 |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione |
| SMILES | COc1ccc(-n2c(N)c(-c3nc4ccccc4s3)sc2=S)cc1 |
| InChI | InChI=1S/C17H13N3OS3/c1-21-11-8-6-10(7-9-11)20-15(18)14(24-17(20)22)16-19-12-4-2-3-5-13(12)23-16/h2-9H,18H2,1H3 |
| InChIKey | LDSUNYVDXPXJKF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione?
The IUPAC name of 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione (CID 4640407) is 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione.
What is the SMILES notation for 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione?
The canonical SMILES for 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione is COc1ccc(-n2c(N)c(-c3nc4ccccc4s3)sc2=S)cc1.
What is the InChIKey of 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione?
The InChIKey is LDSUNYVDXPXJKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3OS3/c1-21-11-8-6-10(7-9-11)20-15(18)14(24-17(20)22)16-19-12-4-2-3-5-13(12)23-16/h2-9H,18H2,1H3.
What are the key properties of 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione?
4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione has a molecular weight of 371.51 g/mol, XLogP of 5.14, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1,3-thiazole-2-thione is sourced from PubChem (CID 4640407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).