C25H26N4O5S — CID 46405892
1-[3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-[methyl-[(2-nitrophenyl)methyl]amino]ethanone (PubChem CID 46405892) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-[methyl-[(2-nitrophenyl)methyl]amino]ethanone.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-[methyl-[(2-nitrophenyl)methyl]amino]ethanone |
|---|---|
| PubChem CID | 46405892 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-[methyl-[(2-nitrophenyl)methyl]amino]ethanone |
| SMILES | COc1ccc(C2CC(c3cccs3)=NN2C(=O)CN(C)Cc2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H26N4O5S/c1-27(15-18-7-4-5-8-20(18)29(31)32)16-25(30)28-21(14-19(26-28)24-9-6-12-35-24)17-10-11-22(33-2)23(13-17)34-3/h4-13,21H,14-16H2,1-3H3 |
| InChIKey | IGMRBNXJLJQROB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|