C21H28F3N3O2 — CID 46407107
N-(2-methylcyclohexyl)-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide (PubChem CID 46407107) has the molecular formula C21H28F3N3O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-methylcyclohexyl)-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46407107 |
| Molecular Formula | C21H28F3N3O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-(2-methylcyclohexyl)-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide |
| SMILES | CC1CCCCC1NC(=O)CN1CCN(C(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H28F3N3O2/c1-15-6-2-5-9-18(15)25-19(28)14-26-10-12-27(13-11-26)20(29)16-7-3-4-8-17(16)21(22,23)24/h3-4,7-8,15,18H,2,5-6,9-14H2,1H3,(H,25,28) |
| InChIKey | YLJIGBSROSPWTH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |