C18H21N3O2S2 — CID 46407451
N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide (PubChem CID 46407451) has the molecular formula C18H21N3O2S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 46407451 |
| Molecular Formula | C18H21N3O2S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1ccccc1SCc1cscn1 |
| InChI | InChI=1S/C18H21N3O2S2/c22-17-7-3-9-21(17)10-4-8-19-18(23)15-5-1-2-6-16(15)25-12-14-11-24-13-20-14/h1-2,5-6,11,13H,3-4,7-10,12H2,(H,19,23) |
| InChIKey | MXBCZAFQSBCYLE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|