C15H14N2O — CID 46407605
N-prop-2-ynyl-2-(4-pyrrol-1-ylphenyl)acetamide (PubChem CID 46407605) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is N-prop-2-ynyl-2-(4-pyrrol-1-ylphenyl)acetamide.
| Compound Name | N-prop-2-ynyl-2-(4-pyrrol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 46407605 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-prop-2-ynyl-2-(4-pyrrol-1-ylphenyl)acetamide |
| SMILES | C#CCNC(=O)Cc1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C15H14N2O/c1-2-9-16-15(18)12-13-5-7-14(8-6-13)17-10-3-4-11-17/h1,3-8,10-11H,9,12H2,(H,16,18) |
| InChIKey | YSBOWSBBUZAYAS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|