About cyclopenten-1-yl acetate
cyclopenten-1-yl acetate (PubChem CID 4640893) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is cyclopenten-1-yl acetate.
Molecular Properties
| Compound Name | cyclopenten-1-yl acetate |
| PubChem CID | 4640893 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | cyclopenten-1-yl acetate |
| SMILES | CC(=O)OC1=CCCC1 |
| InChI | InChI=1S/C7H10O2/c1-6(8)9-7-4-2-3-5-7/h4H,2-3,5H2,1H3 |
| InChIKey | MBVZEDIBUZMQOR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenten-1-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl acetate?
The IUPAC name of cyclopenten-1-yl acetate (CID 4640893) is cyclopenten-1-yl acetate.
What is the SMILES notation for cyclopenten-1-yl acetate?
The canonical SMILES for cyclopenten-1-yl acetate is CC(=O)OC1=CCCC1.
What is the InChIKey of cyclopenten-1-yl acetate?
The InChIKey is MBVZEDIBUZMQOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-6(8)9-7-4-2-3-5-7/h4H,2-3,5H2,1H3.
What are the key properties of cyclopenten-1-yl acetate?
cyclopenten-1-yl acetate has a molecular weight of 126.15 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl acetate is sourced from PubChem (CID 4640893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).