C29H32N2O3 — CID 46410497
N-[[2-(phenoxymethyl)phenyl]methyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide (PubChem CID 46410497) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[[2-(phenoxymethyl)phenyl]methyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[[2-(phenoxymethyl)phenyl]methyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46410497 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | N-[[2-(phenoxymethyl)phenyl]methyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1COc1ccccc1)C1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H32N2O3/c32-28(16-15-23-9-3-1-4-10-23)31-19-17-24(18-20-31)29(33)30-21-25-11-7-8-12-26(25)22-34-27-13-5-2-6-14-27/h1-14,24H,15-22H2,(H,30,33) |
| InChIKey | DRTHWENAOSAGMF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |