C19H29N3O — CID 46411057
4-(1H-benzimidazol-2-yl)-N-(6-methylheptan-2-yl)butanamide (PubChem CID 46411057) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-N-(6-methylheptan-2-yl)butanamide.
| Compound Name | 4-(1H-benzimidazol-2-yl)-N-(6-methylheptan-2-yl)butanamide |
|---|---|
| PubChem CID | 46411057 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-N-(6-methylheptan-2-yl)butanamide |
| SMILES | CC(C)CCCC(C)NC(=O)CCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H29N3O/c1-14(2)8-6-9-15(3)20-19(23)13-7-12-18-21-16-10-4-5-11-17(16)22-18/h4-5,10-11,14-15H,6-9,12-13H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | IJUWOEWVRDTGDG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |